| Name |
Baptigenin |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
5908-63-4 |
| C_ID |
C00009394
, 
|
| InChIKey |
YFVNYAXYZNDLIY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-1-2-9-13(5-8)21-6-10(14(9)19)7-3-11(17)15(20)12(18)4-7/h1-6,16-18,20H |
| SMILES |
O=c1c(-c2cc(O)c(O)c(O)c2)coc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Baptisia tinctoria  | Ref. |
|
|
zoom in
| Organism | Erythroxylum ulei | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|