| Name |
Dryopteric acid 4beta-Carboxymethyl-(-)-epicatechin |
| Formula |
C17H16O8 |
| Mw |
348.08451749 |
| CAS RN |
126655-10-5 |
| C_ID |
C00009317
, 
|
| InChIKey |
SBSHGFDVQPIUCS-MSQBUQHVNA-N |
| InChICode |
InChI=1S/C17H16O8/c18-8-4-12(21)15-9(6-14(22)23)16(24)17(25-13(15)5-8)7-1-2-10(19)11(20)3-7/h1-5,9,16-21,24H,6H2,(H,22,23)/t9-,16+,17+/m0/s1 |
| SMILES |
O=C(O)C[C@H]1c2c(O)cc(O)cc2O[C@H](c2ccc(O)c(O)c2)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Davalliaceae | Davallia divaricata | Ref. |
| Plantae | Davalliaceae | Davallia griffithiana | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Polypodiaceae | Selliguea feei | Ref. |
|
|
zoom in
| Organism | Davallia divaricata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidinsHwang,Phytochem.,29,(1990),279 |
|---|
|