| Name |
Catechin-(4alpha->8)-epicatechin-3-O-gallate |
| Formula |
C37H30O16 |
| Mw |
730.15338491 |
| CAS RN |
89064-33-5 |
| C_ID |
C00009210
, 
|
| InChIKey |
VLFKNLZNDSEVBZ-KVRFJACTNA-N |
| InChICode |
InChI=1S/C37H30O16/c38-16-9-23(44)29-27(10-16)51-35(14-2-4-19(40)22(43)6-14)33(49)31(29)30-24(45)12-20(41)17-11-28(52-37(50)15-7-25(46)32(48)26(47)8-15)34(53-36(17)30)13-1-3-18(39)21(42)5-13/h1-10,12,28,31,33-35,38-49H,11H2/t28-,31-,33-,34+,35+/m0/s1 |
| SMILES |
O=C(O[C@@H]1Cc2c(O)cc(O)c([C@@H]3c4c(O)cc(O)cc4O[C@H](c4ccc(O)c(O)c4)[C@H]3O)c2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Mallotus japonicus  | Ref. |
| Plantae | Polygonaceae | Rheum sp. | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Theaceae | Thea sinensis  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Mallotus japonicus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,Chem.Pharm.Bull,31,(1983),3906 |
|---|
|