| Name |
Procyanidin C2 |
| Formula |
C45H38O18 |
| Mw |
866.20581441 |
| CAS RN |
37064-31-6 |
| C_ID |
C00009091
, 
|
| InChIKey |
MOJZMWJRUKIQGL-GGFYJIHZNA-N |
| InChICode |
InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2/t31-,37+,38+,39+,40+,41-,42-,43-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus radiata | Ref. |
| Plantae | Poaceae | Hordeum vulgare  | Ref. |
| Plantae | Rosaceae | Potentilla viscosa | Ref. |
| Plantae | Salicaceae | Salix caprea  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
|
|
zoom in
| Organism | Betula spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Thompson,J.Chem.Soc.Perkin.Trans.,1,(1972),1387
Brandon,Phytochem.,21,(1982),2953 |
|---|
|