| Name |
Epimesquitol-4alpha-ol Melacacidin |
| Formula |
C15H14O7 |
| Mw |
306.0739528 |
| CAS RN |
38081-16-2 |
| C_ID |
C00009010
, 
|
| InChIKey |
JEUXGAUBSWADEA-AFEJYNATNA-N |
| InChICode |
InChI=1S/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1 |
| SMILES |
Oc1ccc([C@H]2Oc3c(ccc(O)c3O)[C@@H](O)[C@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia galpinii | Ref. |
| Plantae | Fabaceae | Acacia melanoxylon  | Ref. |
| Plantae | Fabaceae | Acacia nigrescens | Ref. |
| Plantae | Fabaceae | Acacia vestita | Ref. |
| Plantae | Fabaceae | Albizia amara  | Ref. |
| Plantae | Fabaceae | Albizia lebbek | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Peltogyne paniculata | Ref. |
| Plantae | Fabaceae | Peltogyne porphyrocardia | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Tephrosia hildebrandtii | Ref. |
| Plantae | Fabaceae | Umtiza listerana | Ref. |
|
|
zoom in
| Organism | Acacia galpinii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Clark-Lewis,J.Chem.Soc.,(1962),4502
Polya,Phytochem.,35,(1994),1399 |
|---|
|