| Name |
Catechin 3-O-alpha-L-rhamnoside |
| Formula |
C21H24O10 |
| Mw |
436.13694699 |
| CAS RN |
103630-03-1 |
| C_ID |
C00008843
, 
|
| InChIKey |
KYLFHITXPCWYAL-BPISQUEENA-N |
| InChICode |
InChI=1S/C21H24O10/c1-8-17(26)18(27)19(28)21(29-8)31-16-7-11-13(24)5-10(22)6-15(11)30-20(16)9-2-3-12(23)14(25)4-9/h2-6,8,16-28H,7H2,1H3/t8-,16-,17-,18+,19-,20+,21-/m0/s1 |
| SMILES |
CC1O[C@@H](O[C@H]2Cc3c(O)cc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus incanus | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Fagaceae | Quercus miyagii | Ref. |
|
|
zoom in
| Organism | Cistus incanus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Morimoto,Chem.Pharm.Bull.,34,(1986),633 |
|---|
|