| Name |
Ourateacatechin (-)-4'-Methylepigallocatechin |
| Formula |
C16H16O7 |
| Mw |
320.08960287 |
| CAS RN |
17291-05-3 |
| C_ID |
C00008820
, 
|
| InChIKey |
ITDYPNOEEHONAH-DDOUFSBJNA-N |
| InChICode |
InChI=1S/C16H16O7/c1-22-16-11(19)2-7(3-12(16)20)15-13(21)6-9-10(18)4-8(17)5-14(9)23-15/h2-5,13,15,17-21H,6H2,1H3/t13-,15-/m1/s1 |
| SMILES |
COc1c(O)cc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Elaeodendron balae | Ref. |
| Plantae | Celastraceae | Elaeodendron glaucum  | Ref. |
| Plantae | Celastraceae | Kokoona zeylanica | Ref. |
| Plantae | Celastraceae | Maytenus heterophylla  | Ref. |
| Plantae | Celastraceae | Maytenus rigida | Ref. |
| Plantae | Celastraceae | Prionostemma aspera  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythropalaceae | Heisteria pallida | Ref. |
| Plantae | Ochnaceae | Ouratea sp. | Ref. |
|
|
zoom in
| Organism | Elaeodendron balae | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Delle Monache,Tetrahedron Lett.,26,(1967),4211
Delle Monache,Phytochem.,15,(1976),573 |
|---|
|