| Name |
Taxifolin 7-O-beta-D-glucopyranoside Taxifolin 7-glucoside 3,5,7,3',4'-Pentahydroxyflavanone 7-beta-D-glucopyranoside |
| Formula |
C21H22O12 |
| Mw |
466.11112617 |
| CAS RN |
14292-40-1 |
| C_ID |
C00008709
, 
|
| InChIKey |
BJAHHJOBSKZTFE-LCULQWKENA-N |
| InChICode |
InChI=1S/C21H22O12/c22-6-13-15(26)17(28)19(30)21(33-13)31-8-4-11(25)14-12(5-8)32-20(18(29)16(14)27)7-1-2-9(23)10(24)3-7/h1-5,13,15,17-26,28-30H,6H2/t13-,15+,17-,18-,19-,20-,21+/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc2O[C@H](c2ccc(O)c(O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Asteraceae | Robinsonia gracilis | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Sorghum sp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus nivalis | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
|
|
zoom in
| Organism | Allium cepa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|