| Name |
Sanggenon L |
| Formula |
C30H32O7 |
| Mw |
504.21480338 |
| CAS RN |
92280-13-2 |
| C_ID |
C00008634
, 
|
| InChIKey |
BWLHLLYREMJAMY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C30H32O7/c1-16(2)7-9-20-25-19(12-13-28(5,6)36-25)24(32)23-26(20)37-30(34)21-10-8-18(31)15-22(21)35-29(30,27(23)33)14-11-17(3)4/h7-8,10-13,15,31-32,34H,9,14H2,1-6H3/t29-,30-/m1/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c1OC1(O)c4ccc(O)cc4OC1(CC=C(C)C)C3=O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus cathayana | Ref. |
| Plantae | Moraceae | Morus mongolica | Ref. |
|
|
zoom in
| Organism | Morus alba |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
