| Name |
Flemiphilippinin D Kushenol E |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
99119-72-9 |
| C_ID |
C00008466
, 
|
| InChIKey |
ZTEYEFPSJPSRRA-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O6/c1-13(2)5-8-17-23(29)18(9-6-14(3)4)25-22(24(17)30)20(28)12-21(31-25)16-10-7-15(26)11-19(16)27/h5-7,10-11,21,26-27,29-30H,8-9,12H2,1-4H3/t21-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)CC(c1ccc(O)cc1O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Euchresta horsfeldii | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| - | - | Moghania philippinensis | Ref. |
|
|
zoom in
| Organism | Euchresta horsfeldii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 583,Flavanones and dihydroflavonols
Wu,J.Pharm.Soc.Jpn,105,(1985),736 |
|---|
|