| Name |
Euchrenone a5 |
| Formula |
C25H26O4 |
| Mw |
390.18310932 |
| CAS RN |
125140-20-7 |
| C_ID |
C00008458
, 
|
| InChIKey |
VSUQUSVBOASRIA-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O4/c1-15(2)5-7-18-20(26)9-8-19-21(27)14-23(28-24(18)19)16-6-10-22-17(13-16)11-12-25(3,4)29-22/h5-6,8-13,23,26H,7,14H2,1-4H3/t23-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)ccc2c1OC(c1ccc3c(c1)C=CC(C)(C)O3)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
|
|
zoom in
| Organism | Euchresta formosana |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 574,Flavanones and dihydroflavonols
Mizuno,Phytochem.,28,(1989),2811 |
|---|
|
