| Name |
4'-Methylsigmoidin B |
| Formula |
C21H22O6 |
| Mw |
370.14163844 |
| CAS RN |
114340-00-0 |
| C_ID |
C00008456
, 
|
| InChIKey |
UYGBXGAZUCKDDV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O6/c1-11(2)4-5-12-6-13(7-17(25)21(12)26-3)18-10-16(24)20-15(23)8-14(22)9-19(20)27-18/h4,6-9,18,22-23,25H,5,10H2,1-3H3/t18-/m0/s1 |
| SMILES |
COc1c(O)cc(C2CC(=O)c3c(O)cc(O)cc3O2)cc1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina berteroana | Ref. |
| Plantae | Fabaceae | Erythrina sacleuxii | Ref. |
| Plantae | Fabaceae | Erythrina velutina | Ref. |
|
|
zoom in
| Organism | Erythrina berteroana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 573,Flavanones and dihydroflavonols
Maillard,Plant Med.,53,(1987),563
Mailard,Planta Med.,55,(1989),281 |
|---|
|