| Name |
(2S)-Euchrenone a7 (-)-(2S)-Euchrenone a7 Euchrenone a7 |
| Formula |
C20H20O5 |
| Mw |
340.13107375 |
| CAS RN |
130252-50-5 |
| C_ID |
C00008452
, 
|
| InChIKey |
JJOUBYOHNYJCOU-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O5/c1-11(2)3-5-14-16(22)8-7-15-18(24)10-19(25-20(14)15)13-6-4-12(21)9-17(13)23/h3-4,6-9,19,21-23H,5,10H2,1-2H3/t19-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)ccc2c1OC(c1ccc(O)cc1O)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Euchresta horsfeldii | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Moraceae | Artocarpus communis  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
|
|
zoom in
| Organism | Euchresta horsfeldii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 568,Flavanones and dihydroflavonols
Mizuno,Phytochem.,29,(1990),2738 |
|---|
|