| Name |
Xambioona |
| Formula |
C25H24O4 |
| Mw |
388.16745925 |
| CAS RN |
82345-36-6 |
| C_ID |
C00008432
, 
|
| InChIKey |
FGJUXFVUOCKRCY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H24O4/c1-24(2)11-9-16-13-15(5-7-20(16)28-24)22-14-19(26)17-6-8-21-18(23(17)27-22)10-12-25(3,4)29-21/h5-13,22H,14H2,1-4H3/t22-/m1/s1 |
| SMILES |
CC1(C)C=Cc2cc(C3CC(=O)c4ccc5c(c4O3)C=CC(C)(C)O5)ccc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Calopogonium mucuno | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza sp. | Ref. |
|
|
zoom in
| Organism | Calopogonium mucuno | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 548,Flavanones and dihydroflavonols
Pereira,Phytochem.,21,(1982),488 |
|---|
|