| Name |
Candidone |
| Formula |
C22H24O4 |
| Mw |
352.16745925 |
| CAS RN |
77727-18-5 |
| C_ID |
C00008385
, 
|
| InChIKey |
JYESOAFLKFHYHP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C22H24O4/c1-14(2)10-11-16-19(24-3)13-20(25-4)21-17(23)12-18(26-22(16)21)15-8-6-5-7-9-15/h5-10,13,18H,11-12H2,1-4H3/t18-/m1/s1 |
| SMILES |
COc1cc(OC)c2c(c1CC=C(C)C)OC(c1ccccc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lonchocarpus costaricensis | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Tephrosia candida | Ref. |
| Plantae | Fabaceae | Tephrosia elata  | Ref. |
|
|
zoom in
| Organism | Lonchocarpus costaricensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 499,Flavanones and dihydroflavonols
Lwande,J.Nat.Prod.,48,(1985),1004 |
|---|
|