| Name |
Sanggenon G |
| Formula |
C40H38O11 |
| Mw |
694.24141206 |
| CAS RN |
85698-31-3 |
| C_ID |
C00008383
, 
|
| InChIKey |
VYCKCQBOVSSJSK-JGCQYDHQNA-N |
| InChICode |
InChI=1S/C40H38O11/c1-19(2)4-3-5-20-12-27(24-9-6-21(41)14-29(24)44)36(39(49)26-11-8-23(43)16-31(26)46)28(13-20)37-32(47)18-35-38(40(37)50)33(48)17-34(51-35)25-10-7-22(42)15-30(25)45/h4,6-11,13-16,18,27-28,34,36,41-47,50H,3,5,12,17H2,1-2H3/t27-,28-,34-,36-/m1/s1 |
| SMILES |
CC(C)=CCCC1=CC(c2c(O)cc3c(c2O)C(=O)CC(c2ccc(O)cc2O)O3)[C@H](C(=O)c2ccc(O)cc2O)[C@@H](c2ccc(O)cc2O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus mongolica  | Ref. |
|
|
zoom in
| Organism | Morus alba | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., Shenyang Yaoke Daxue Xuebao, 20, (2003), 386.
Shi, et al., JNP, 64, (2001), 181 |
|---|
|