| Name |
Norartocarpanone Steppogenin 5,7,2',4'-Tetrahydroxyflavanone |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
56486-94-3 |
| C_ID |
C00008367
, 
|
| InChIKey |
QBLQLKNOKUHRCH-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-7-1-2-9(10(18)3-7)13-6-12(20)15-11(19)4-8(17)5-14(15)21-13/h1-5,13,16-19H,6H2/t13-/m1/s1 |
| SMILES |
O=C1CC(c2ccc(O)cc2O)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia stepposa | Ref. |
| Plantae | Moraceae | Artocarpus dadah  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Ficus formosana | Ref. |
|
|
zoom in
| Organism | Euphorbia stepposa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 480,Flavanones and dihydroflavonols
Sotnikova,Khim.Prir.Soedin,4,(1968),82 |
|---|
|