| Name |
(2S)-5,7,2',5'-Tetrahydroxyflavanone 5,7,2',5'-Tetrahydroxyflavanone |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
74175-75-0 |
| C_ID |
C00008354
, 
|
| InChIKey |
XVXXIRQXOYAJAF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-7-1-2-10(18)9(3-7)13-6-12(20)15-11(19)4-8(17)5-14(15)21-13/h1-5,13,16-19H,6H2/t13-/m1/s1 |
| SMILES |
O=C1CC(c2cc(O)ccc2O)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Asteraceae | Tanacetum sibiricum | Ref. |
| Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
|
|
zoom in
| Organism | Inula cappa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 467,Flavanones and dihydroflavonols
Baruah,Phytochem.,18,(1979),2003 |
|---|
|