| Name |
Persicogenin |
| Formula |
C17H16O6 |
| Mw |
316.09468824 |
| CAS RN |
28590-40-1 |
| C_ID |
C00008300
, 
|
| InChIKey |
LWBHKKLWSUFUNZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O6/c1-21-10-6-12(19)17-13(20)8-15(23-16(17)7-10)9-3-4-14(22-2)11(18)5-9/h3-7,15,18-19H,8H2,1-2H3/t15-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)OC(c1ccc(OC)c(O)c1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pteridaceae | Notholaena spp. | Ref. |
| Plantae | Rosaceae | Prunus davidiana  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| - | - | Persica vulgaris  | Ref. |
|
|
zoom in
| Organism | Notholaena spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 413,Flavanones and dihydroflavonols
Christiansen,Tetrahedron Lett.,(1966),1293 |
|---|
|