| Name |
Hesperetin 7-O-glucoside |
| Formula |
C22H24O11 |
| Mw |
464.13186161 |
| CAS RN |
2500-68-7 |
| C_ID |
C00008297
, 
|
| InChIKey |
ADSYMQORONDIDD-DLZCQZRJNA-N |
| InChICode |
InChI=1S/C22H24O11/c1-30-14-3-2-9(4-11(14)24)15-7-13(26)18-12(25)5-10(6-16(18)32-15)31-22-21(29)20(28)19(27)17(8-23)33-22/h2-6,15,17,19-25,27-29H,7-8H2,1H3/t15-,17-,19-,20+,21-,22-/m1/s1 |
| SMILES |
COc1ccc(C2CC(=O)c3c(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3O2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Mentha aquatica  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
| Organism | Mentha aquatica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 408,Flavanones and dihydroflavonols
Burzanska-Hermann,Acta Pol.Pharm.,35,(1978),673
Baslas,Herba Hung,22,(1983),85 |
|---|
|