| Name |
Butin-7-O-beta-D-glucopyranoside Isocoreopsin |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
30382-18-4 |
| C_ID |
C00008279
, 
|
| InChIKey |
AWENDZQUFCJISN-YWZRKEQENA-N |
| InChICode |
InChI=1S/C21H22O10/c22-8-17-18(26)19(27)20(28)21(31-17)29-10-2-3-11-13(24)7-15(30-16(11)6-10)9-1-4-12(23)14(25)5-9/h1-6,15,17-23,25-28H,7-8H2/t15-,17+,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=C1CC(c2ccc(O)c(O)c2)Oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Bidens sp. | Ref. |
| Plantae | Asteraceae | Coreopsis sp. | Ref. |
| Plantae | Asteraceae | Cosmos sp. | Ref. |
| Plantae | Asteraceae | Dahlia sp. | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
|
|
zoom in
| Organism | Bidens sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 385,Flavanones and dihydroflavonols
Puri,J.Sci.Ind.Res.India,13B,(1954),321 |
|---|
|