| Name |
Bonannione A Mimulone 6-Geranylnaringenin |
| Formula |
C25H28O5 |
| Mw |
408.193674 |
| CAS RN |
97126-57-3 |
| C_ID |
C00008273
, 
|
| InChIKey |
XYIQIBWIEGCVQY-FRKPEAEDNA-N |
| InChICode |
InChI=1S/C25H28O5/c1-15(2)5-4-6-16(3)7-12-19-20(27)13-23-24(25(19)29)21(28)14-22(30-23)17-8-10-18(26)11-9-17/h5,7-11,13,22,26-27,29H,4,6,12,14H2,1-3H3/b16-7+/t22-/m0/s1 |
| SMILES |
CC(C)=CCC/C(C)=C/Cc1c(O)cc2c(c1O)C(=O)CC(c1ccc(O)cc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bonannia graeca | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Euphorbiaceae | Macaranga alnifolia | Ref. |
| Plantae | Moraceae | Artocarpus communis  | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Phrymaceae | Diplacus aurantiacus | Ref. |
| Plantae | Sarcolaenaceae | Schizolaena hystrix | Ref. |
|
|
zoom in
| Organism | Bonannia graeca | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 379,Flavanones and dihydroflavonols
Bruno,Heterocycles,23,(1985),1147 |
|---|
|