| Name |
Cajaflavanone Erythrisenegalone |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
68236-12-4 |
| C_ID |
C00008249
, 
|
| InChIKey |
TXWYWZHIUMRYOS-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)5-10-17-22(28)21-19(27)13-20(15-6-8-16(26)9-7-15)29-24(21)18-11-12-25(3,4)30-23(17)18/h5-9,11-12,20,26,28H,10,13H2,1-4H3/t20-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)c2c(c3c1OC(C)(C)C=C3)OC(c1ccc(O)cc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cajanus cajan  | Ref. |
| Plantae | Fabaceae | Erythrina fusca  | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Lespedeza floribunda | Ref. |
|
|
zoom in
| Organism | Cajanus cajan | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 356,Flavanones and dihydroflavonols
Bhanumati,Phytochem.,17,(1978),2045 |
|---|
|