| Name |
Isocarthamidin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
2569-76-8 |
| C_ID |
C00008232
, 
|
| InChIKey |
NUNODKNZSZKXGY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)12-6-10(18)13-9(17)5-11(19)14(20)15(13)21-12/h1-5,12,16-17,19-20H,6H2/t12-/m1/s1 |
| SMILES |
O=C1CC(c2ccc(O)cc2)Oc2c(O)c(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis | Ref. |
|
|
zoom in
| Organism | Carthamus tinctorius |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
