| Name |
Carthamidin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
479-54-9 |
| C_ID |
C00008230
, 
|
| InChIKey |
NPLTVGMLNDMOQE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-4,6,11,16,18-20H,5H2/t11-/m0/s1 |
| SMILES |
O=C1CC(c2ccc(O)cc2)Oc2cc(O)c(O)c(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
|
|
zoom in
| Organism | Carthamus tinctorius | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|