| Name |
Naringenin 5,7-dimethyl ether
5,7-Di-O-methylnaringenin |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
72704-06-4 |
| C_ID |
C00008227
, 
|
| InChIKey |
REBBZOCNEVVAPX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O5/c1-20-12-7-15(21-2)17-13(19)9-14(22-16(17)8-12)10-3-5-11(18)6-4-10/h3-8,14,18H,9H2,1-2H3/t14-/m1/s1 |
| SMILES |
COc1cc(OC)c2c(c1)OC(c1ccc(O)cc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis alaternoides | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
|
|
zoom in
| Organism | Baccharis alaternoides |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 334,Flavanones and dihydroflavonols
Bohlmann,Phytochem.,18,(1979),1011 |
|---|
|
