| Name |
Abyssinone IV |
| Formula |
C25H28O4 |
| Mw |
392.19875938 |
| CAS RN |
77263-10-6 |
| C_ID |
C00008202
, 
|
| InChIKey |
JBQLRZGPTDOWQA-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O4/c1-15(2)5-7-17-11-19(12-18(25(17)28)8-6-16(3)4)23-14-22(27)21-10-9-20(26)13-24(21)29-23/h5-6,9-13,23,26,28H,7-8,14H2,1-4H3/t23-/m1/s1 |
| SMILES |
CC(C)=CCc1cc(C2CC(=O)c3ccc(O)cc3O2)cc(CC=C(C)C)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina addisoniae | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
|
|
zoom in
| Organism | Erythrina abyssinica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 301,Flavanones and dihydroflavonols
Kamat,Heterocycles,15,(1981),1163 |
|---|
|