| Name |
Abyssinone II (2S)-Abyssinone II |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
77263-08-2 |
| C_ID |
C00008201
, 
|
| InChIKey |
NLTOTZSPOYWSSP-IBGZPJMESA-N |
| InChICode |
InChI=1S/C20H20O4/c1-12(2)3-4-13-9-14(5-8-17(13)22)19-11-18(23)16-7-6-15(21)10-20(16)24-19/h3,5-10,19,21-22H,4,11H2,1-2H3/t19-/m0/s1 |
| SMILES |
CC(C)=CCc1cc(C2CC(=O)c3ccc(O)cc3O2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
|
|
zoom in
| Organism | Erythrina abyssinica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 300,Flavanones and dihydroflavonols
Kamat,Heterocycles,15,(1981),1163 |
|---|
|