| Name |
5,7-Dihydroxy-8-C-geranylflavanone |
| Formula |
C25H28O4 |
| Mw |
392.19875938 |
| CAS RN |
77222-70-9 |
| C_ID |
C00008176
, 
|
| InChIKey |
SPOAVFOKSZPUQS-SFQUDFHCNA-N |
| InChICode |
InChI=1S/C25H28O4/c1-16(2)8-7-9-17(3)12-13-19-20(26)14-21(27)24-22(28)15-23(29-25(19)24)18-10-5-4-6-11-18/h4-6,8,10-12,14,23,26-27H,7,9,13,15H2,1-3H3/b17-12+/t23-/m0/s1 |
| SMILES |
CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)c2c1OC(c1ccccc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum hypocephalum | Ref. |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
|
|
zoom in
| Organism | Helichrysum hypocephalum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 272,Flavanones and dihydroflavonols
Bohlmann,Phytochem.,18,(1979),1851 |
|---|
|