| Name |
Obovatin methyl ether 5-Methoxyisolonchocarpin Pongachin |
| Formula |
C21H20O4 |
| Mw |
336.13615913 |
| CAS RN |
69640-78-4 |
| C_ID |
C00008173
, 
|
| InChIKey |
ITOTUSMHIQFNHJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H20O4/c1-21(2)10-9-14-17(25-21)12-18(23-3)19-15(22)11-16(24-20(14)19)13-7-5-4-6-8-13/h4-10,12,16H,11H2,1-3H3/t16-/m0/s1 |
| SMILES |
COc1cc2c(c3c1C(=O)CC(c1ccccc1)O3)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lonchocarpus costaricensis | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Tephrosia emoroides | Ref. |
|
|
zoom in
| Organism | Lonchocarpus costaricensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 269,Flavanones and dihydroflavonols
Chem.Agric.Biol.Chem.,42,(1978),2431 |
|---|
|