| Name |
7-Hydroxyflavanone |
| Formula |
C15H12O3 |
| Mw |
240.07864425 |
| CAS RN |
6515-36-2 |
| C_ID |
C00008126
, 
|
| InChIKey |
SWAJPHCXKPCPQZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-8,14,16H,9H2/t14-/m0/s1 |
| SMILES |
O=C1CC(c2ccccc2)Oc2cc(O)ccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Flourensia heterolepis | Ref. |
| Plantae | Ericaceae | Ceratiola ericoides | Ref. |
| Plantae | Fabaceae | Diplotropis purpurea | Ref. |
| Plantae | Fabaceae | Platymiscium praecox | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Vatairea heteroptera | Ref. |
| Plantae | Fabaceae | Virgilia oroboides | Ref. |
| Plantae | Myristicaceae | Virola surinamensis  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
|
|
zoom in
| Organism | Flourensia heterolepis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 218,Flavanones and dihydroflavonols
Braga de Oliveira,Phytochem.,11,(1972),3515
Bohlmann,Phytochem.,18,(1979),1189 |
|---|
|