| Name |
Sanggenon E |
| Formula |
C45H44O12 |
| Mw |
776.28327687 |
| CAS RN |
81381-69-3 |
| C_ID |
C00008106
, 
|
| InChIKey |
CUJJTBMGUHNKPO-GXQCSOQPNA-N |
| InChICode |
InChI=1S/C45H44O12/c1-21(2)6-9-27-32(48)13-11-28(40(27)51)41(52)37-29(26-10-7-24(46)18-33(26)49)16-23(5)17-30(37)38-34(50)20-36-39(42(38)53)43(54)44(15-14-22(3)4)45(55,57-36)31-12-8-25(47)19-35(31)56-44/h6-8,10-14,17-20,29-30,37,46-51,53,55H,9,15-16H2,1-5H3/t29-,30-,37-,44+,45-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)ccc(C(=O)[C@@H]2[C@@H](c3ccc(O)cc3O)CC(C)=C[C@H]2c2c(O)cc3c(c2O)C(=O)C2(CC=C(C)C)Oc4cc(O)ccc4C2(O)O3)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus mongolica  | Ref. |
|
|
zoom in
| Organism | Morus alba | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|