| Name |
Dihydromilletenone methyl ether |
| Formula |
C19H20O6 |
| Mw |
344.12598837 |
| CAS RN |
96400-40-7 |
| C_ID |
C00007958
, 
|
| InChIKey |
DTXKPYYJPVZPRP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H20O6/c1-21-13-5-6-14(18(9-13)23-3)15(20)10-17(22-2)12-4-7-16-19(8-12)25-11-24-16/h4-9,17H,10-11H2,1-3H3/t17-/m1/s1 |
| SMILES |
COc1ccc(C(=O)CC(OC)c2ccc3c(c2)OCO3)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia hemsleyana | Ref. |
| Plantae | Fabaceae | Millettia leucantha | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
|
|
zoom in
| Organism | Millettia hemsleyana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Mahmoud,Phytochem.,24,(1985),369 |
|---|
|