| Name |
Rubranine |
| Formula |
C25H26O4 |
| Mw |
390.18310932 |
| CAS RN |
31759-29-2 |
| C_ID |
C00007133
, 
|
| InChIKey |
JBBGZRUAGCHOGS-RJKRTFLMNA-N |
| InChICode |
InChI=1S/C25H26O4/c1-24(2)17-11-12-25(3)14-16(17)21-20(28-25)13-19(27)22(23(21)29-24)18(26)10-9-15-7-5-4-6-8-15/h4-10,13,16-17,27H,11-12,14H2,1-3H3/b10-9+/t16-,17-,25+/m0/s1 |
| SMILES |
CC1(C)Oc2c(C(=O)/C=C/c3ccccc3)c(O)cc3c2[C@H]2C[C@@](C)(CC[C@@H]21)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Aniba rosaeodora  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (L.) Mansf.Kulturpfl.  | Ref. |
|
|
zoom in
| Organism | Aniba rosaeodora | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
de Alleluia,Phytochem.,17,(1978),517
Tuntiwachwuttikul,Aust.J.Chem.,37,(1984),449 |
|---|
|