| Name |
4'-Geranyloxy-4,2'-dihydroxychalcone 4'-O-Geranylisoliquiritigenin |
| Formula |
C25H28O4 |
| Mw |
392.19875938 |
| CAS RN |
130289-23-5 |
| C_ID |
C00007123
, 
|
| InChIKey |
YGNHPWQWWZLUBY-UHGDPLQBSA-N |
| InChICode |
InChI=1S/C25H28O4/c1-18(2)5-4-6-19(3)15-16-29-22-12-13-23(25(28)17-22)24(27)14-9-20-7-10-21(26)11-8-20/h5,7-15,17,26,28H,4,6,16H2,1-3H3/b14-9+,19-15+ |
| SMILES |
CC(C)=CCC/C(C)=C/COc1ccc(C(=O)/C=C/c2ccc(O)cc2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia ferruginea  | Ref. |
| Plantae | Fabaceae | Millettia griffoniana | Ref. |
| Plantae | Fabaceae | Millettia usaramensis subsp. usaramensis  | Ref. |
|
|
zoom in
| Organism | Millettia ferruginea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Dagne,Phytochem.,29,(1990),2671 |
|---|
|