| Name |
Xanthohumol |
| Formula |
C21H22O5 |
| Mw |
354.14672381 |
| CAS RN |
569-83-5 |
| C_ID |
C00007099
, 
|
| InChIKey |
ORXQGKIUCDPEAJ-YRNVUSSQSA-N |
| InChICode |
InChI=1S/C21H22O5/c1-13(2)4-10-16-18(24)12-19(26-3)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-9,11-12,22,24-25H,10H2,1-3H3/b11-7+ |
| SMILES |
COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Sophora angustifolia | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Humulus lupulus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Orth,Liebigs Ann.Chem.,663,(1963),74
Komatsu,Yakugaku Zasshi,90,(1970),463 |
|---|
|