| Name |
Ovalichalcone A |
| Formula |
C23H24O6 |
| Mw |
396.1572885 |
| CAS RN |
73291-17-5 |
| C_ID |
C00007035
, 
|
| InChIKey |
YYYWPOYCOARRNU-RMKNXTFCSA-N |
| InChICode |
InChI=1S/C23H24O6/c1-14(2)5-8-16-19(26-3)12-21(27-4)22(23(16)25)17(24)9-6-15-7-10-18-20(11-15)29-13-28-18/h5-7,9-12,25H,8,13H2,1-4H3/b9-6+ |
| SMILES |
COc1cc(OC)c(C(=O)/C=C/c2ccc3c(c2)OCO3)c(O)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dahlstedtia pentaphylla | Ref. |
| Plantae | Fabaceae | Millettia ovalifolia | Ref. |
| - | - | Milletia ovalifolia | Ref. |
|
|
zoom in
| Organism | Dahlstedtia pentaphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Gupta,Indian J.Chem.Sect.B.,17,(1979),291
Garcez,Phytochem.,27,(1988),1079 |
|---|
|