| Name |
Vincanin B Delphinidin 3-(6-rhamnosylgalactoside) |
| Formula |
C27H31O16 |
| Mw |
611.16120995 |
| CAS RN |
68735-95-5 |
| C_ID |
C00006703
, 
|
| InChIKey |
PLKUTZNSKRWCCA-GTNINITKNA-O |
| InChICode |
InChI=1S/C27H30O16/c1-8-18(32)21(35)23(37)26(40-8)39-7-17-20(34)22(36)24(38)27(43-17)42-16-6-11-12(29)4-10(28)5-15(11)41-25(16)9-2-13(30)19(33)14(31)3-9/h2-6,8,17-18,20-24,26-27,32,34-38H,7H2,1H3,(H4-,28,29,30,31,33)/p+1/t8-,17-,18-,20-,21-,22-,23+,24-,26+,27+/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc4c(O)cc(O)cc4[o+]c3-c3cc(O)c(O)c(O)c3)C(O)C(O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Vinca major  | Ref. |
| Plantae | Boraginaceae | Lobostemon spp. | Ref. |
| Plantae | Iridaceae | Crocus chrysanthus | Ref. |
| Plantae | Liliaceae | Tulipa gesneriana  | Ref. |
| Plantae | Linaceae | Linum grandiflorum | Ref. |
| Plantae | Musaceae | Musa x paradisiaca | Ref. |
| Plantae | Solanaceae | Petunia reitzii | Ref. |
|
|
zoom in
| Organism | Vinca major | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Jarman,Phytochem.,12,(1973),171
Ishikura,Bot.Mag.Tokyo,91,(1978),181 |
|---|
|