| Name |
Cyanidin 3-sambubioside-5-glucoside |
| Formula |
C32H39O20 |
| Mw |
743.20346869 |
| CAS RN |
53925-33-0 |
| C_ID |
C00006673
, 
|
| InChIKey |
OLBLWNPOURNBCY-QUUAACIINA-O |
| InChICode |
InChI=1S/C32H38O20/c33-7-19-22(40)24(42)27(45)31(50-19)48-17-5-11(35)4-16-12(17)6-18(28(47-16)10-1-2-13(36)14(37)3-10)49-32-29(25(43)23(41)20(8-34)51-32)52-30-26(44)21(39)15(38)9-46-30/h1-6,15,19-27,29-34,38-45H,7-9H2,(H2-,35,36,37)/p+1/t15-,19+,20-,21-,22+,23+,24-,25-,26-,27+,29+,30+,31+,32+/m0/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O[C@@H]2OC[C@@H](O)C(O)[C@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Sambucus canadensis  | Ref. |
| Plantae | Adoxaceae | Sambucus ebulus  | Ref. |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Matthiola incana  | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
|
|
zoom in
| Organism | Sambucus canadensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Johansen,Phytochem.,30,(1991),4137 |
|---|
|