| Name |
Cyanidin 3-sophoroside Cyanidin-3-sophoroside |
| Formula |
C27H31O16 |
| Mw |
611.16120995 |
| CAS RN |
38820-68-7,18376-31-3 |
| C_ID |
C00006658
, 
|
| InChIKey |
SXYMMDGPXYVCER-XWOBYZRTNA-O |
| InChICode |
InChI=1S/C27H30O16/c28-7-17-19(34)21(36)23(38)26(41-17)43-25-22(37)20(35)18(8-29)42-27(25)40-16-6-11-13(32)4-10(30)5-15(11)39-24(16)9-1-2-12(31)14(33)3-9/h1-6,17-23,25-29,34-38H,7-8H2,(H3-,30,31,32,33)/p+1/t17-,18+,19-,20-,21+,22+,23-,25-,26+,27-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Stapelia spp. | Ref. |
| Plantae | Aquifoliaceae | Ilex pubescens  | Ref. |
| Plantae | Asteraceae | Cynara scolymus  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Convolvulaceae | Ipomoea purpurea  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus spp. | Ref. |
| Plantae | Crassulaceae | Cotyledon spp. | Ref. |
| Plantae | Crassulaceae | Crassula spp. | Ref. |
| Plantae | Crassulaceae | Tylecodon spp. | Ref. |
| Plantae | Fabaceae | Amphithalea spp. | Ref. |
| Plantae | Fabaceae | Coelidium spp. | Ref. |
| Plantae | Fabaceae | Erythrina spp. | Ref. |
| Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
| Plantae | Fabaceae | Liparia spp. | Ref. |
| Plantae | Grossulariaceae | Ribes spp.  | Ref. |
| Plantae | Malvaceae | Abelmoschus spp. | Ref. |
| Plantae | Malvaceae | Thespesia spp. | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Rosaceae | Rubus idaeus  | Ref. |
| Plantae | Solanaceae | Nicotiana setchellii | Ref. |
|
|
zoom in
| Organism | Stapelia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85 |
|---|
|