| Name |
Calodenin B |
| Formula |
C30H20O9 |
| Mw |
524.11073224 |
| CAS RN |
118045-66-2 |
| C_ID |
C00006551
, 
|
| InChIKey |
OYSSHUWICGHBOU-KGVSQERTSA-N |
| InChICode |
InChI=1S/C30H20O9/c31-17-6-1-15(2-7-17)3-12-21(34)25-23(36)14-24(37)26-27(28(38)20-11-10-19(33)13-22(20)35)29(39-30(25)26)16-4-8-18(32)9-5-16/h1-14,31-33,35-37H/b12-3+ |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)c1c(O)cc(O)c2c(C(=O)c3ccc(O)cc3O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Cordia goetzei | Ref. |
| Plantae | Ochnaceae | Brackenridgea zanguebarica  | Ref. |
| Plantae | Ochnaceae | Ochna afzelii  | Ref. |
| Plantae | Ochnaceae | Ochna calodendron | Ref. |
|
|
zoom in
| Organism | Cordia goetzei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Drewes,J.Chem.Soc.Perkin Trans.,1,(1987),2809
Messanga,Phytochem.,35,(1994),791 |
|---|
|