| Name |
Amentoflavone 4',7''-dimethyl ether 4',7''-Di-O-methylamentoflavone |
| Formula |
C32H22O10 |
| Mw |
566.12129692 |
| CAS RN |
34394-13-3 |
| C_ID |
C00006493
, 
|
| InChIKey |
OVCFMRWVQJAWDY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C32H22O10/c1-39-24-8-5-16(26-12-21(36)30-20(35)10-18(34)11-28(30)41-26)9-19(24)29-27(40-2)14-23(38)31-22(37)13-25(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-35,38H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1-c1c(OC)cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria cunninghamii  | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| - | - | Selaginella spp. | Ref. |
|
|
zoom in
| Organism | Araucaria cunninghamii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Khan,Chem.Pharm.Bull.,19,(1971),1500 |
|---|
|