| Name |
5',3'''-Dihydroxyrobustaflavone |
| Formula |
C30H18O12 |
| Mw |
570.07982604 |
| CAS RN |
114865-40-6 |
| C_ID |
C00006476
, 
|
| InChIKey |
JMMCAUBTQWVZOE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O12/c31-13-6-17(34)27-19(36)8-23(42-24(27)7-13)12-3-14(29(39)21(38)5-12)26-18(35)10-25-28(30(26)40)20(37)9-22(41-25)11-1-2-15(32)16(33)4-11/h1-10,31-35,38-40H |
| SMILES |
O=c1cc(-c2cc(O)c(O)c(-c3c(O)cc4oc(-c5ccc(O)c(O)c5)cc(=O)c4c3O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aulacomniaceae | Aulacomnium palustre | Ref. |
| Plantae | Dicranaceae | Campylopus clavatus | Ref. |
| Plantae | Dicranaceae | Campylopus holomitrium | Ref. |
| Plantae | Dicranaceae | Dicranoloma robustum | Ref. |
| Plantae | Hylocomiaceae | Hylocomium splendens | Ref. |
| Plantae | Mniaceae | Plagiomnium cuspidatum | Ref. |
| Plantae | Mniaceae | Plagiomnium undulatum | Ref. |
| - | - | Racomitrium lanuginosum | Ref. |
|
|
zoom in
| Organism | Aulacomnium palustre | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Becker,Z.Naturforsch.C.,41,(1986),507
Markham.Phytochem.,27,(1988),1745 |
|---|
|