| Name |
Dicranolomin |
| Formula |
C30H18O12 |
| Mw |
570.07982604 |
| CAS RN |
116383-34-7 |
| C_ID |
C00006468
, 
|
| InChIKey |
ZFNKROZSXXJHKW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O12/c31-12-6-17(35)26-18(36)9-22(42-23(26)7-12)13-2-4-15(33)29(39)25(13)28-20(38)10-24-27(30(28)40)19(37)8-21(41-24)11-1-3-14(32)16(34)5-11/h1-10,31-35,38-40H |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2-c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aulacomniaceae | Aulacomnium palustre | Ref. |
| Plantae | Dicranaceae | Dicranoloma robustum | Ref. |
| Plantae | Plantaginaceae | Bartramia pomiformis | Ref. |
| Plantae | Plantaginaceae | Bartramia stricta | Ref. |
| - | - | Philonotis fontana | Ref. |
|
|
zoom in
| Organism | Aulacomnium palustre | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Markham,Phytochem.,27,(1988),1745 |
|---|
|