| Name |
Cupressuflavone 7,4',7''-trimethyl ether |
| Formula |
C33H24O10 |
| Mw |
580.13694699 |
| CAS RN |
63043-60-7 |
| C_ID |
C00006463
, 
|
| InChIKey |
MQOXLMURYUCRGW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C33H24O10/c1-39-19-10-6-17(7-11-19)25-13-21(36)29-23(38)15-27(41-3)31(33(29)43-25)30-26(40-2)14-22(37)28-20(35)12-24(42-32(28)30)16-4-8-18(34)9-5-16/h4-15,34,37-38H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(OC)c(-c4c(OC)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Agathis atropurpurea | Ref. |
| Plantae | Araucariaceae | Agathis australis  | Ref. |
| Plantae | Araucariaceae | Agathis ovata | Ref. |
| Plantae | Araucariaceae | Araucaria cunninghamii  | Ref. |
|
|
zoom in
| Organism | Agathis atropurpurea | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Khan,Chem.Pharm.Bull.,19,(1971),1500 |
|---|
|