| Name |
4'-O-Methylcupressuflavone |
| Formula |
C31H20O10 |
| Mw |
552.10564686 |
| CAS RN |
69389-66-8 |
| C_ID |
C00006460
, 
|
| InChIKey |
BITALAJTVXTKFL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H20O10/c1-39-17-8-4-15(5-9-17)25-13-23(38)27-19(34)11-21(36)29(31(27)41-25)28-20(35)10-18(33)26-22(37)12-24(40-30(26)28)14-2-6-16(32)7-3-14/h2-13,32-36H,1H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4c(O)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bakeriana | Ref. |
| Plantae | Cupressaceae | Cupressus lusitanica  | Ref. |
|
|
zoom in
| Organism | Garcinia bakeriana | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|