| Name |
Lanceolatin B |
| Formula |
C31H22O10 |
| Mw |
554.12129692 |
| CAS RN |
159194-99-7 |
| C_ID |
C00006450
, 
|
| InChIKey |
XHNHPCLUJQCMPT-QOOOMNBCNA-N |
| InChICode |
InChI=1S/C31H22O10/c1-39-18-11-22(36)28-23(37)13-24(40-26(28)12-18)15-4-7-20(34)19(8-15)27-30(38)29-21(35)9-17(33)10-25(29)41-31(27)14-2-5-16(32)6-3-14/h2-13,27,31-36H,1H3/t27-,31+/m0/s1 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)c([C@@H]4C(=O)c5c(O)cc(O)cc5O[C@H]4c4ccc(O)cc4)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
| Plantae | Fabaceae | Dahlstedtia pinnata | Ref. |
| Plantae | Fabaceae | Lonchocarpus mollis | Ref. |
| Plantae | Fabaceae | Millettia erythrocalyx | Ref. |
| Plantae | Fabaceae | Millettia hemsleyana | Ref. |
| Plantae | Fabaceae | Millettia peguensis | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Millettia sanagana | Ref. |
| Plantae | Fabaceae | Tephrosia falciformis | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Ochnaceae | Lophira lanceolata | Ref. |
|
|
zoom in
| Organism | Cephalotaxus lanceolata |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
