| Name |
Isovitexin 7,2''-di-O-glucoside |
| Formula |
C33H40O20 |
| Mw |
756.21129372 |
| CAS RN |
83213-36-9 |
| C_ID |
C00006322
, 
|
| InChIKey |
HCMCYDZSIBHFMM-IFKMJLCMNA-N |
| InChICode |
InChI=1S/C33H40O20/c34-7-16-23(41)27(45)31(53-33-29(47)26(44)22(40)18(9-36)52-33)30(49-16)20-15(50-32-28(46)25(43)21(39)17(8-35)51-32)6-14-19(24(20)42)12(38)5-13(48-14)10-1-3-11(37)4-2-10/h1-6,16-18,21-23,25-37,39-47H,7-9H2/t16-,17+,18+,21-,22-,23-,25+,26+,27+,28-,29-,30+,31-,32-,33+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Cerastium arvense | Ref. |
| Plantae | Caryophyllaceae | Melandrium album  | Ref. |
| Plantae | Caryophyllaceae | Silene pratensis | Ref. |
|
|
zoom in
| Organism | Cerastium arvense | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Van Brederode,Biochem.Genet.,11,(1974),65
Dubois,Phytochem.,21,(1982),1141 |
|---|
|