| Name |
Isoviolanthin |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
40788-84-9 |
| C_ID |
C00006236
, 
|
| InChIKey |
TWBWSPDILHVKEV-AILJZSFINA-N |
| InChICode |
InChI=1S/C27H30O14/c1-8-17(31)21(35)23(37)26(39-8)15-19(33)14-11(30)6-12(9-2-4-10(29)5-3-9)40-25(14)16(20(15)34)27-24(38)22(36)18(32)13(7-28)41-27/h2-6,8,13,17-18,21-24,26-29,31-38H,7H2,1H3/t8-,13+,17+,18-,21+,22+,23-,24-,26+,27+/m1/s1 |
| SMILES |
CC1O[C@@H](c2c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c3oc(-c4ccc(O)cc4)cc(=O)c3c2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Marattiaceae | Angiopteris evecta  | Ref. |
| Plantae | Passifloraceae | Passiflora sexflora | Ref. |
|
|
zoom in
| Organism | Conocephalum conicum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Wallance,Phytochem.,18,(1979),1077
McCormick,J.Nat.Prod.,45,(1982),782 |
|---|
|