| Name |
Swertisin 8-methyl ether Precatorin I 6-beta-D-Glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C23H24O11 |
| Mw |
476.13186161 |
| CAS RN |
120727-05-1 |
| C_ID |
C00006149
, 
|
| InChIKey |
LRJVZJKYYZEITI-LFEZTXSONA-N |
| InChICode |
InChI=1S/C23H24O11/c1-31-21-15(20-19(30)18(29)16(27)13(8-24)34-20)17(28)14-11(26)7-12(33-22(14)23(21)32-2)9-3-5-10(25)6-4-9/h3-7,13,16,18-20,24-25,27-30H,8H2,1-2H3/t13-,16-,18+,19-,20+/m1/s1 |
| SMILES |
COc1c([C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)c(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Siphonoglossa sp. | Ref. |
| Plantae | Fabaceae | Abrus precatorius  | Ref. |
| Plantae | Fabaceae | Abrus precatorius L.  | Ref. |
|
|
zoom in
| Organism | Siphonoglossa sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Hilsenbeck,Phytochem.,29,(1990),2181 |
|---|
|